| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Rieke Metals, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (402) 434-2775 | |||
![]() |
sales@riekemetals.com | |||
| Chemical manufacturer | ||||
| Name | 1-(2,6-Difluorophenyl)-3-(1,3-dioxan-2-yl)-1-propanone |
|---|---|
| Synonyms | 2',6'-difluoro-3-(1,3-dioxan-2-yl)propiophenone; 2',6'-DIFLUORO-3-(1,3-DIOXAN-2-YL)-PROPIOPHENONE; MFCD02261813 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14F2O3 |
| Molecular Weight | 256.25 |
| CAS Registry Number | 884504-27-2 |
| SMILES | Fc2cccc(F)c2C(=O)CCC1OCCCO1 |
| InChI | 1S/C13H14F2O3/c14-9-3-1-4-10(15)13(9)11(16)5-6-12-17-7-2-8-18-12/h1,3-4,12H,2,5-8H2 |
| InChIKey | HZENEIYYVFTLAQ-UHFFFAOYSA-N |
| Density | 1.218g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.525°C at 760 mmHg (Cal.) |
| Flash point | 152.709°C (Cal.) |
| Refractive index | 1.487 (Cal.) |
| SDS | Available |
|---|---|
| (1) | S. S. Golotvin, E. Vodopianov, R. Pol, B. A. Lefebvre, A. J. Williams, R. D. Rutkowske and T. D. Spitzer. Automated structure verification based on a combination of 1D 1H NMR and 2D 1H–13C HSQC spectra, Magn. Reson. Chem. 2007, 45, 803–813 |
|---|---|
| Market Analysis Reports |