| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Hexagon Labs | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 977-2723 | |||
![]() |
sales@hexagonlabs.com | |||
| Chemical manufacturer since 2005 | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Classification | API >> Synthetic anti-infective drugs >> Sulfonamides and synergists |
|---|---|
| Name | 4-(Aminosulfonyl)-Benzenepropanoic Acid |
| Synonyms | 3-(4-Sulfamoylphenyl)Propionate; Zinc04362893 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10NO4S |
| Molecular Weight | 228.24 |
| CAS Registry Number | 90610-69-8 |
| SMILES | C1=C([S](=O)(=O)N)C=CC(=C1)CCC([O-])=O |
| InChI | 1S/C9H11NO4S/c10-15(13,14)8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5H,3,6H2,(H,11,12)(H2,10,13,14)/p-1 |
| InChIKey | JUEONDBIBADVGD-UHFFFAOYSA-M |
| Boiling point | 459.033°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 231.415°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |