Online Database of Chemicals from Around the World
|
CAS#: 99282-16-3 Product: 3-(Fluoromethyl)-3-Butenyl Diphosphate No suppilers available for the product. |
| Name | 3-(Fluoromethyl)-3-Butenyl Diphosphate |
|---|---|
| Synonyms | 3-(Fluoromethyl)-3-Butenyl Diphosphate; Diphosphoric Acid, Mono(3-(Fluoromethyl)-3-Butenyl) Ester; Fipp |
| Molecular Structure |  |
| Molecular Formula | C5H11FO7P2 |
| Molecular Weight | 264.08 |
| CAS Registry Number | 99282-16-3 |
| SMILES | C(O[P](=O)(O)O[P](=O)(O)O)CC(=C)CF |
| InChI | 1S/C5H11FO7P2/c1-5(4-6)2-3-12-15(10,11)13-14(7,8)9/h1-4H2,(H,10,11)(H2,7,8,9) |
| InChIKey | RHZKOFJYQGKKAO-UHFFFAOYSA-N |
| Density | 1.601g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.203°C at 760 mmHg (Cal.) |
| Flash point | 229.099°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Fluoromethyl)-3-Butenyl Diphosphate |