Online Database of Chemicals from Around the World
|
CAS#: 112318-40-8 Product: 6-Epitetrodotoxin No suppilers available for the product. |
| Name | 6-Epitetrodotoxin |
|---|---|
| Synonyms | Tetrodotoxin, (6Beta)- |
| Molecular Structure |  |
| Molecular Formula | C11H17N3O8 |
| Molecular Weight | 319.27 |
| CAS Registry Number | 112318-40-8 |
| SMILES | [C@@]124NC(=N[C@H](O)C1[C@H]3O[C@@](O[C@@H](C2O)[C@@]3(O)CO)(O)[C@H]4O)N |
| InChI | 1S/C11H17N3O8/c12-8-13-6(17)2-4-9(19,1-15)5-3(16)10(2,14-8)7(18)11(20,21-4)22-5/h2-7,15-20H,1H2,(H3,12,13,14)/t2?,3?,4-,5+,6-,7+,9-,10-,11+/m1/s1 |
| InChIKey | CFMYXEVWODSLAX-YPXFGVONSA-N |
| Density | 2.784g/cm3 (Cal.) |
|---|---|
| Boiling point | 702.642°C at 760 mmHg (Cal.) |
| Flash point | 378.745°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Epitetrodotoxin |