| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Ukrorgsyntez Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+38 (044) 531-9497 | |||
![]() |
sales@uorsy.com | |||
| Chemical manufacturer since 2001 | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2-Oxo-3-[4-(Trifluoromethyl)Phenyl]Propanoic Acid |
|---|---|
| Synonyms | 3-(4-Trifluoromethylphenyl)-2-oxopropionic acid; Benzenepropanoic acid, α-oxo-4-(trifluoromethyl)-; MFCD08234689 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7F3O3 |
| Molecular Weight | 232.16 |
| CAS Registry Number | 120658-71-1 |
| SMILES | C1=CC(=CC=C1CC(=O)C(=O)O)C(F)(F)F |
| InChI | 1S/C10H7F3O3/c11-10(12,13)7-3-1-6(2-4-7)5-8(14)9(15)16/h1-4H,5H2,(H,15,16) |
| InChIKey | WKPBMQOVUPFRHQ-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.9±42.0°C at 760 mmHg (Cal.) |
| Flash point | 136.4±27.9°C (Cal.) |
| Refractive index | 1.485 (Cal.) |
| (1) | Patricia Busca, Francesca Paradisi, Eamonn Moynihan, Anita R. Maguire and Paul C. Engel. Enantioselective synthesis of non-natural amino acids using phenylalanine dehydrogenases modified by site-directed mutagenesis, Org. Biomol. Chem., 2004, 2, 2684. |
|---|---|
| Market Analysis Reports |