Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-(2alpha,7beta-Dihydro-2alpha,7beta-Dimethyl-1,2-Dioxeto[3,4-b]Benzofuran-4-Yl)-Ethanone |
|---|---|
| Synonyms | Ccris 4153 |
| Molecular Structure | ![CAS#: 128753-86-6， 1-(2alpha,7beta-Dihydro-2alpha,7beta-Dimethyl-1,2-Dioxeto[3,4-b]Benzofuran-4-Yl)-Ethanone](/moreStructures/128753-86-6.gif) |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 |
| CAS Registry Number | 128753-86-6 |
| SMILES | C2=C1C3(C(OC1=C(C=C2)C(=O)C)(OO3)C)C |
| InChI | 1S/C12H12O4/c1-7(13)8-5-4-6-9-10(8)14-12(3)11(9,2)15-16-12/h4-6H,1-3H3 |
| InChIKey | VPSOTEYZOPXZJE-UHFFFAOYSA-N |
| Density | 1.302g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.101°C at 760 mmHg (Cal.) |
| Flash point | 138.715°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2alpha,7beta-Dihydro-2alpha,7beta-Dimethyl-1,2-Dioxeto[3,4-b]Benzofuran-4-Yl)-Ethanone |