Online Database of Chemicals from Around the World
|
CAS#: 131190-63-1 Product: 1,3,8,10,11-Pentahydroxytetracene-5,12-Dione No suppilers available for the product. |
| Name | 1,3,8,10,11-Pentahydroxytetracene-5,12-Dione |
|---|---|
| Synonyms | 1,3,8,10,11-Pentahydroxytetracene-5,12-Quinone; 5,12-Naphthacenedione, 1,3,8,10,11-Pentahydroxy-; Saintopin |
| Molecular Structure |  |
| Molecular Formula | C18H10O7 |
| Molecular Weight | 338.27 |
| CAS Registry Number | 131190-63-1 |
| SMILES | C1=C4C(=C(O)C2=C1C(=O)C3=C(C2=O)C(=CC(=C3)O)O)C(=CC(=C4)O)O |
| InChI | 1S/C18H10O7/c19-7-1-6-2-9-15(17(24)13(6)11(21)4-7)18(25)14-10(16(9)23)3-8(20)5-12(14)22/h1-5,19-22,24H |
| InChIKey | CGFVUVWMYIHGHS-UHFFFAOYSA-N |
| Density | 1.825g/cm3 (Cal.) |
|---|---|
| Boiling point | 701.406°C at 760 mmHg (Cal.) |
| Flash point | 391.957°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,8,10,11-Pentahydroxytetracene-5,12-Dione |