| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | (2-Chloro-1,1,1,3,3,3-Hexafluoro-2-Propanyl)Benzene |
|---|---|
| Synonyms | (1-Chloro-2,2,2-trifluoro-1-trifluoromethyl-; (1-CHLORO-2,2,2-TRIFLUORO-1-TRIFLUOROMETHYL-ETHYL)-BENZENE; (2-CHLORO)HEXAFLUORO-2-PHENYLPROPANE |
| Molecular Structure | ![]() |
| Molecular Formula | C9H5ClF6 |
| Molecular Weight | 262.58 |
| CAS Registry Number | 16878-50-5 |
| SMILES | ClC(c1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | 1S/C9H5ClF6/c10-7(8(11,12)13,9(14,15)16)6-4-2-1-3-5-6/h1-5H |
| InChIKey | DGTQQDMGYPZUIN-UHFFFAOYSA-N |
| Density | 1.429g/cm3 (Cal.) |
|---|---|
| Boiling point | 159°C (Expl.) |
| 143.992°C at 760 mmHg (Cal.) | |
| Flash point | 58.644°C (Cal.) |
| Refractive index | 1.412 (Cal.) |
| Safety Description | Irritant |
|---|---|
| R36/37/38 | |
| S23,S24/25,S36/37/39,S45 | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for (2-Chloro-1,1,1,3,3,3-Hexafluoro-2-Propanyl)Benzene |