| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 3,3'-(3,3,4,4,5,5-Hexafluoro-1-Cyclopentene-1,2-Diyl)Bis(2,4-Dimethyl-5-Phenylthiophene) |
|---|---|
| Synonyms | 1,2-Bis(2 |
| Molecular Structure | ![]() |
| Molecular Formula | C29H22F6S2 |
| Molecular Weight | 548.61 |
| CAS Registry Number | 172612-67-8 |
| SMILES | CC1=C(SC(=C1C2=C(C(C(C2(F)F)(F)F)(F)F)C3=C(SC(=C3C)C4=CC=CC=C4)C)C)C5=CC=CC=C5 |
| InChI | 1S/C29H22F6S2/c1-15-21(17(3)36-25(15)19-11-7-5-8-12-19)23-24(28(32,33)29(34,35)27(23,30)31)22-16(2)26(37-18(22)4)20-13-9-6-10-14-20/h5-14H,1-4H3 |
| InChIKey | DYZAFEDVNIEMEL-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 536.0±50.0°C at 760 mmHg (Cal.) |
| Flash point | 278.0±30.1°C (Cal.) |
| Refractive index | 1.605 (Cal.) |
| (1) | Yukihide Ishibashi, Katsuki Okuno, Chikashi Ota, Toshiyuki Umesato, Tetsuro Katayama, Masataka Murakami, Seiya Kobatake, Masahiro Irie and Hiroshi Miyasaka. Multiphoton-gated cycloreversion reactions of photochromic diarylethene derivatives with low reaction yields upon one-photon visible excitation, Photochem. Photobiol. Sci., 2010, 9, 172. |
|---|---|
| Market Analysis Reports |