Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 3-(2-Amino-2-Iminoethyl)Benzoic Acid |
|---|---|
| Synonyms | 3-Carbamimidoylmethyl benzoic acid; 3-Carbamimidoylmethyl-benzoic acid; 3-Carbamimidoylmethylbenzoicacid |
| Molecular Structure |  |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 |
| CAS Registry Number | 183430-28-6 |
| SMILES | C1=CC(=CC(=C1)C(=O)O)CC(=N)N |
| InChI | 1S/C9H10N2O2/c10-8(11)5-6-2-1-3-7(4-6)9(12)13/h1-4H,5H2,(H3,10,11)(H,12,13) |
| InChIKey | JQCBHVKQBLOSBD-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.2±52.0°C at 760 mmHg (Cal.) |
| Flash point | 188.0±30.7°C (Cal.) |
| Refractive index | 1.602 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Amino-2-Iminoethyl)Benzoic Acid |