| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| chemBlink standard supplier since 2018 | ||||
| AccuStandard Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (203) 786-5290 | |||
![]() |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Chemodex Ltd. | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (71) 244-4825 | |||
![]() |
info@chemodex.com | |||
| Chemical distributor | ||||
| Classification | Analytical chemistry >> Standard >> Pesticides, veterinary drugs and fertilizers |
|---|---|
| Name | 6-Iodo-2-Propoxy-3-Propyl-4(3H)-Quinazolinone |
| Synonyms | 4(3H)-Quinazolinone, 6-iodo-2-propoxy-3-propyl- |
| Molecular Formula | C14H17IN2O2 |
| Molecular Weight | 372.20 |
| CAS Registry Number | 189278-12-4 |
| SMILES | Ic2ccc1\N=C(\OCCC)N(C(=O)c1c2)CCC |
| InChI | 1S/C14H17IN2O2/c1-3-7-17-13(18)11-9-10(15)5-6-12(11)16-14(17)19-8-4-2/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | FLVBXVXXXMLMOX-UHFFFAOYSA-N |
| Density | 1.576g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.14°C at 760 mmHg (Cal.) |
| Flash point | 216.965°C (Cal.) |
| Refractive index | 1.625 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 6-Iodo-2-Propoxy-3-Propyl-4(3H)-Quinazolinone |