| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 1-(2,4-Dihydroxyphenyl)-2-(4-Hydroxyphenyl)Propan-1-One |
|---|---|
| Synonyms | 1-Propanone, 1-(2,4-Dihydroxyphenyl)-2-(4-Hydroxyphenyl)-; O-Desmethylangolensin |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 |
| CAS Registry Number | 21255-69-6 |
| SMILES | C2=C(C(C(C1=CC=C(C=C1)O)C)=O)C(=CC(=C2)O)O |
| InChI | 1S/C15H14O4/c1-9(10-2-4-11(16)5-3-10)15(19)13-7-6-12(17)8-14(13)18/h2-9,16-18H,1H3 |
| InChIKey | JDJPNKPFDDUBFV-UHFFFAOYSA-N |
| Density | 1.33g/cm3 (Cal.) |
|---|---|
| Boiling point | 483.317°C at 760 mmHg (Cal.) |
| Flash point | 260.207°C (Cal.) |
| (1) | Kristiina Wähälä, Tuija Jokela, Auli Salakka, Seppo Kaltia and Markku Mesilaakso. Regioselectivity of methylation of O-demethylangolensin [1-(2,4-dihydroxyphenyl)-2-(4-hydroxyphenyl)propan-1-one]. An expedient synthesis of angolensin, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 642. |
|---|---|
| Market Analysis Reports |