Online Database of Chemicals from Around the World
| DSL Chemicals (Shanghai) Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (21) 6352-9955 | |||
 |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Epsilon Chimie Chemical Manufacturer | France | Inquire | ||
|---|---|---|---|---|
|
+33 (2) 9842-4650 | |||
|
pierre.cornec@epsilon-chimie.com | |||
| Chemical manufacturer | ||||
| Name | Tetraethyl-1,4-Benzenediphosphonate |
|---|---|
| Synonyms | Tetraethyl 1,4-Phenylenebisphosphonate; Phosphonic Acid, 1,4-Phenylenebis-, Tetraethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C14H24O6P2 |
| Molecular Weight | 350.29 |
| CAS Registry Number | 21267-14-1 |
| EINECS | 244-303-8 |
| SMILES | C1=CC(=CC=C1[P](OCC)(OCC)=O)[P](OCC)(OCC)=O |
| InChI | 1S/C14H24O6P2/c1-5-17-21(15,18-6-2)13-9-11-14(12-10-13)22(16,19-7-3)20-8-4/h9-12H,5-8H2,1-4H3 |
| InChIKey | KNUANRUJDWJWGY-UHFFFAOYSA-N |
| Density | 1.179g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.627°C at 760 mmHg (Cal.) |
| Flash point | 219.204°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetraethyl-1,4-Benzenediphosphonate |