Online Database of Chemicals from Around the World
|
CAS#: 21273-12-1 Product: Trimethylsilyl 6-Phenoxyhexanoate No suppilers available for the product. |
| Name | Trimethylsilyl 6-Phenoxyhexanoate |
|---|---|
| Synonyms | Trimethylsilyl 6-phenoxyhexanoate # |
| Molecular Structure |  |
| Molecular Formula | C15H24O3Si |
| Molecular Weight | 280.43 |
| CAS Registry Number | 21273-12-1 |
| SMILES | O=C(O[Si](C)(C)C)CCCCCOc1ccccc1 |
| InChI | 1S/C15H24O3Si/c1-19(2,3)18-15(16)12-8-5-9-13-17-14-10-6-4-7-11-14/h4,6-7,10-11H,5,8-9,12-13H2,1-3H3 |
| InChIKey | ODSMYLIMADKSBY-UHFFFAOYSA-N |
| Density | 0.985g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.318°C at 760 mmHg (Cal.) |
| Flash point | 130.156°C (Cal.) |
| Refractive index | 1.477 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethylsilyl 6-Phenoxyhexanoate |