| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Oakwood Products, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (800) 467-3386 | |||
![]() |
k_weaver@oakwoodchemical.com | |||
| Chemical manufacturer | ||||
| Paragos e. K. | Germany | |||
|---|---|---|---|---|
![]() |
+49 2330-8079751 | |||
![]() |
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Rare Chemicals GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (431) 5606-600 | |||
![]() |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Classification | Flavors and spices >> Synthetic spice >> Aromatic cinnamic acid, esters and derivatives |
|---|---|
| Name | (2E)-3-[4-Fluoro-2-(Trifluoromethyl)Phenyl]Acrylic Acid |
| Synonyms | 2-PROPENOIC ACID,3-[4-FLUORO-2-(TRIFLUOROMETHYL)PHENYL]-; 3-(4-Fluoro-2-trifluoromethyl-phenyl)-acrylic acid; 4-FLUORO-2-(TRIFLUOROMETHYL)CINNAMICACID |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6F4O2 |
| Molecular Weight | 234.15 |
| CAS Registry Number | 243977-21-1 |
| SMILES | C1=CC(=C(C=C1F)C(F)(F)F)/C=C/C(=O)O |
| InChI | 1S/C10H6F4O2/c11-7-3-1-6(2-4-9(15)16)8(5-7)10(12,13)14/h1-5H,(H,15,16)/b4-2+ |
| InChIKey | OREHSCSLACWBTF-DUXPYHPUSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 181-183°C (Expl.) |
| Boiling point | 268.2±35.0°C at 760 mmHg (Cal.) |
| Flash point | 116.0±25.9°C (Cal.) |
| Refractive index | 1.51 (Cal.) |
| Safety Code | S26;S37 Details |
|---|---|
| Risk Code | R36/37/38 Details |
| Hazard Symbol | X Details |
| Safety Description | Irritant |
| IRRITANT | |
| WARNING: Irritates lungs, eyes, skin | |
| S22,S24/25,S36/37/39,S45 | |
| R36/37/38 | |
| SDS | Available |
| Market Analysis Reports |