Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | N-Methoxy-N-Methyl-2-(Phenylsulfonyl)Acetamide |
|---|---|
| Synonyms | ACETAMIDE,N-METHOXY-N-METHYL-2-(PHENYLSULFONYL)-; N-Methoxy-N-methyl-2-phenylsulfonyl acetamide; 561088_ALDRICH |
| Molecular Structure |  |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 |
| CAS Registry Number | 258874-02-1 |
| SMILES | O=S(=O)(c1ccccc1)CC(=O)N(OC)C |
| InChI | 1S/C10H13NO4S/c1-11(15-2)10(12)8-16(13,14)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey | JREIEAVKXTZABZ-UHFFFAOYSA-N |
| Density | 1.271g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.613°C at 760 mmHg (Cal.) |
| Flash point | 189.431°C (Cal.) |
| Refractive index | 1.537 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Methoxy-N-Methyl-2-(Phenylsulfonyl)Acetamide |