Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Cupric Methionline |
|---|---|
| Synonyms | Copper L-Methionine; CUPRIC METHIONLINE |
| Molecular Structure |  |
| Molecular Formula | C10H20CuN2O4S2 |
| Molecular Weight | 359.95 |
| CAS Registry Number | 32817-16-6 |
| SMILES | CSCC[C@@H](C(=O)O[Cu]OC(=O)[C@H](CCSC)N)N |
| InChI | 1S/2C5H11NO2S.Cu/c2*1-9-3-2-4(6)5(7)8;/h2*4H,2-3,6H2,1H3,(H,7,8);/q;;+2/p-2/t2*4-;/m00./s1 |
| Market Analysis Reports |