|
CAS#: 343857-47-6 Product: Tricyclo[3.3.2.03,7]Decane-1-Carbonyl Chloride No suppilers available for the product. |
| Name | Tricyclo[3.3.2.03,7]Decane-1-Carbonyl Chloride |
|---|---|
| Synonyms | 2,5-Ethanopentalene-2(1H)-carbonyl chloride, hexahydro-; 2,5-ETHANOPENTALENE-2(1H)-CARBONYLCHLORIDE, HEXAHYDRO-; Chlorure de tricyclo[3.3.2.03,7]décane-1-ca |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15ClO |
| Molecular Weight | 198.69 |
| CAS Registry Number | 343857-47-6 |
| SMILES | C1CC2(CC3CC1CC3C2)C(=O)Cl |
| InChI | 1S/C11H15ClO/c12-10(13)11-2-1-7-3-8(5-11)9(4-7)6-11/h7-9H,1-6H2 |
| InChIKey | PRXZSTRRBGUJEF-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 256.2±9.0°C at 760 mmHg (Cal.) |
| Flash point | 139.0±8.3°C (Cal.) |
| Refractive index | 1.556 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tricyclo[3.3.2.03,7]Decane-1-Carbonyl Chloride |