Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Squarix GmbH | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 (2365) 915-278/ | |||
|
order@squarix.de,info@squarix.de | |||
| Chemical manufacturer since 1992 | ||||
| Name | 6-Ethylguanine |
|---|---|
| Synonyms | (6-Ethoxy-7H-Purin-2-Yl)Amine; Purine, 2-Amino-6-Ethoxy-; O6-Substituted Guanine Deriv. 2 |
| Molecular Structure |  |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 |
| CAS Registry Number | 51866-19-4 |
| SMILES | C2=NC1=C(C(=NC(=N1)N)OCC)[NH]2 |
| InChI | 1S/C7H9N5O/c1-2-13-6-4-5(10-3-9-4)11-7(8)12-6/h3H,2H2,1H3,(H3,8,9,10,11,12) |
| InChIKey | SFXXRVSPZSOREJ-UHFFFAOYSA-N |
| Density | 1.441g/cm3 (Cal.) |
|---|---|
| Boiling point | 569.005°C at 760 mmHg (Cal.) |
| Flash point | 297.924°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Ethylguanine |