| Leap Chem Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (852) 3060-6658 | |||
![]() |
market19@leapchem.com | |||
![]() |
QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2022 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Classification | Inorganic chemical industry >> Inorganic salt >> Oxides and peroxides >> Metal oxide |
|---|---|
| Name | Dicaesium tungstate |
| Synonyms | Cesium tungstate; dicaesium(1+) ion dioxotungstenbis(olate) |
| Molecular Structure | ![]() |
| Molecular Formula | Cs2O4W |
| Molecular Weight | 513.65 |
| CAS Registry Number | 52350-17-1 |
| SMILES | [O-][W](=O)(=O)[O-].[Cs+].[Cs+] |
| InChI | 1S/2Cs.4O.W/q2*+1;;;2*-1; |
| InChIKey | VPXSRGLTQINCRV-UHFFFAOYSA-N |
| Flash point | -200°C (Expl.) |
|---|---|
| Safety Description | WARNING: Irritates skin and eyes |
|---|---|
| Market Analysis Reports |