Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6-Amino-2,3,5-biphenyltriol |
|---|---|
| Synonyms | 6-amino-[1,1'-biphenyl]-2,3,5-triol |
| Molecular Structure |  |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 |
| CAS Registry Number | 615572-38-8 |
| SMILES | c1ccc(cc1)c2c(c(cc(c2O)O)O)N |
| InChI | 1S/C12H11NO3/c13-11-8(14)6-9(15)12(16)10(11)7-4-2-1-3-5-7/h1-6,14-16H,13H2 |
| InChIKey | SIMJJRGHFBJIIP-UHFFFAOYSA-N |
| Density | 1.426g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.882°C at 760 mmHg (Cal.) |
| Flash point | 211.366°C (Cal.) |
| Refractive index | 1.729 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Amino-2,3,5-biphenyltriol |