Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Ethyl-4,6-dinitroaniline |
|---|---|
| Synonyms | 2-ethyl-4,6-dinitroaniline; BENZENAMINE,2-ETHYL-4,6-DINITRO- |
| Molecular Structure |  |
| Molecular Formula | C8H9N3O4 |
| Molecular Weight | 211.17 |
| CAS Registry Number | 719298-81-4 |
| SMILES | CCc1cc(cc(N(=O)=O)c1N)N(=O)=O |
| InChI | 1S/C8H9N3O4/c1-2-5-3-6(10(12)13)4-7(8(5)9)11(14)15/h3-4H,2,9H2,1H3 |
| InChIKey | GNFCQROEFMBUQG-UHFFFAOYSA-N |
| Density | 1.425g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.64°C at 760 mmHg (Cal.) |
| Flash point | 211.825°C (Cal.) |
| Refractive index | 1.635 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethyl-4,6-dinitroaniline |