Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 (431) 5606-600 | |||
|
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4-Ethyl 2-methyl 1-methyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| Synonyms | 4-ethyl 2-methyl 1-methyl-1H-pyrrole-2,4-dicarboxylate |
| Molecular Structure |  |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.21 |
| CAS Registry Number | 773138-57-1 |
| SMILES | CCOC(=O)c1cc(n(c1)C)C(=O)OC |
| InChI | 1S/C10H13NO4/c1-4-15-9(12)7-5-8(10(13)14-3)11(2)6-7/h5-6H,4H2,1-3H3 |
| InChIKey | KBBBEBCZDCEONN-UHFFFAOYSA-N |
| Density | 1.168g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.527°C at 760 mmHg (Cal.) |
| Flash point | 137.369°C (Cal.) |
| Refractive index | 1.509 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethyl 2-methyl 1-methyl-1H-pyrrole-2,4-dicarboxylate |