|
CAS#: 78904-44-6 Product: 1,3-Dimethoxy-2-[(1E)-2-nitro-1-propen-1-yl]benzene No suppilers available for the product. |
| Name | 1,3-Dimethoxy-2-[(1E)-2-nitro-1-propen-1-yl]benzene |
|---|---|
| Synonyms | 1,3-Dimethoxy-2-[(1E)-2-nitro-1-propenyl]benzene #; cis-2,6-Dimethoxy-β-methyl-β-nitrostyrene |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 |
| CAS Registry Number | 78904-44-6 |
| SMILES | [O-][N+](=O)\C(=C\c1c(OC)cccc1OC)C |
| InChI | 1S/C11H13NO4/c1-8(12(13)14)7-9-10(15-2)5-4-6-11(9)16-3/h4-7H,1-3H3/b8-7+ |
| InChIKey | BTHUWEKTWWOHCT-BQYQJAHWSA-N |
| Density | 1.169g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.822°C at 760 mmHg (Cal.) |
| Flash point | 153.963°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dimethoxy-2-[(1E)-2-nitro-1-propen-1-yl]benzene |