Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 5,5-Dimethyl-6-(3-methylphenyl)-2-hexanol |
|---|---|
| Synonyms | 5,5-dimethyl-6-(m-tolyl)hexan-2-ol |
| Molecular Structure |  |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 827299-40-1 |
| SMILES | OC(C)CCC(Cc1cccc(c1)C)(C)C |
| InChI | 1S/C15H24O/c1-12-6-5-7-14(10-12)11-15(3,4)9-8-13(2)16/h5-7,10,13,16H,8-9,11H2,1-4H3 |
| InChIKey | RWDMFISBWVZPLG-UHFFFAOYSA-N |
| Density | 0.936g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.877°C at 760 mmHg (Cal.) |
| Flash point | 109.091°C (Cal.) |
| Refractive index | 1.505 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5-Dimethyl-6-(3-methylphenyl)-2-hexanol |