| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-Trifluoromethyl-1H-Quinolin-4-One |
|---|---|
| Synonyms | 2-(Trifluoromethyl)-4-Quinolone; 2-(Trifluoromethyl)Quinolin-4-Ol; Mls000850599 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6F3NO |
| Molecular Weight | 213.16 |
| CAS Registry Number | 83842-55-1 |
| SMILES | C1=C2C(=CC=C1)NC(=CC2=O)C(F)(F)F |
| InChI | 1S/C10H6F3NO/c11-10(12,13)9-5-8(15)6-3-1-2-4-7(6)14-9/h1-5H,(H,14,15) |
| InChIKey | SUNAMHNJYSQUPL-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 208-211°C (Expl.) |
| Boiling point | 299.1±35.0°C at 760 mmHg (Cal.) |
| Flash point | 134.7±25.9°C (Cal.) |
| Safety Description | WARNING: Irritates skin and eyes, harmful if swallowed |
|---|---|
| DANGER: POISON, irritates skin, eyes, lungs | |
| Market Analysis Reports |
| List of Reports Available for 2-Trifluoromethyl-1H-Quinolin-4-One |