Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 7-Fluoro-1-oxaspiro[4.5]deca-6,9-dien-8-one |
|---|---|
| Synonyms | 7-fluoro-1-oxaspiro[4.5]deca-6,9-dien-8-one |
| Molecular Structure | ![CAS#: 839694-38-1， 7-Fluoro-1-oxaspiro[4.5]deca-6,9-dien-8-one](/moreStructures/839694-38-1.gif) |
| Molecular Formula | C9H9FO2 |
| Molecular Weight | 168.16 |
| CAS Registry Number | 839694-38-1 |
| SMILES | C1CC2(C=CC(=O)C(=C2)F)OC1 |
| InChI | 1S/C9H9FO2/c10-7-6-9(3-1-5-12-9)4-2-8(7)11/h2,4,6H,1,3,5H2 |
| InChIKey | DDOBBLWAIHDDKP-UHFFFAOYSA-N |
| Density | 1.24g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.282°C at 760 mmHg (Cal.) |
| Flash point | 128.221°C (Cal.) |
| Refractive index | 1.52 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Fluoro-1-oxaspiro[4.5]deca-6,9-dien-8-one |