Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 3-Methyl-6-(trifluoromethyl)-1H-indole |
|---|---|
| Synonyms | 6-(Trifluoromethyl)-3-methylindole |
| Molecular Structure |  |
| Molecular Formula | C10H8F3N |
| Molecular Weight | 199.17 |
| CAS Registry Number | 884494-59-1 |
| SMILES | Cc1c[nH]c2c1ccc(c2)C(F)(F)F |
| InChI | 1S/C10H8F3N/c1-6-5-14-9-4-7(10(11,12)13)2-3-8(6)9/h2-5,14H,1H3 |
| InChIKey | ILZTWXURGRBKKI-UHFFFAOYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 271.225°C at 760 mmHg (Cal.) |
| Flash point | 117.833°C (Cal.) |
| Refractive index | 1.55 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-6-(trifluoromethyl)-1H-indole |