Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N5-Ethyl-2,5-pyrazinediamine 1-oxide |
|---|---|
| Synonyms | 2-amino-5-(ethylamino)pyrazine 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 |
| CAS Registry Number | 900140-31-0 |
| SMILES | CCNC1=NC=C([N+](=C1)[O-])N |
| InChI | 1S/C6H10N4O/c1-2-8-6-4-10(11)5(7)3-9-6/h3-4H,2,7H2,1H3,(H,8,9) |
| InChIKey | RHVKGYGWIDWPRT-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 503.9±45.0°C at 760 mmHg (Cal.) |
| Flash point | 258.5±28.7°C (Cal.) |
| Refractive index | 1.625 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N5-Ethyl-2,5-pyrazinediamine 1-oxide |