| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | Tetrabromoterephthalic Acid |
|---|---|
| Synonyms | 524441_Aldrich; Tetrabromoterephthalic Acid; Nsc12442 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H2Br4O4 |
| Molecular Weight | 481.72 |
| CAS Registry Number | 5411-70-1 |
| SMILES | C1(=C(C(=C(C(=C1Br)Br)C(O)=O)Br)Br)C(O)=O |
| InChI | 1S/C8H2Br4O4/c9-3-1(7(13)14)4(10)6(12)2(5(3)11)8(15)16/h(H,13,14)(H,15,16) |
| InChIKey | PNXPXUDJXYVOFM-UHFFFAOYSA-N |
| Density | 2.688g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.76°C at 760 mmHg (Cal.) |
| Flash point | 251.208°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Cheng-Peng Li, Jing Chen and Miao Du. Structural diversification and metal-directed assembly of coordination architectures based on tetrabromoterephthalic acid and a bent dipyridyl tecton 2,5-bis(4-pyridyl)-1,3,4-oxadiazole, CrystEngComm, 2010, 12, 4392. |
|---|---|
| Market Analysis Reports |