|
CAS#: 91687-65-9 Product: N-[1-(4-Bromophenyl)Ethyl]-2-Chloroacetamide No suppilers available for the product. |
| Name | N-[1-(4-Bromophenyl)Ethyl]-2-Chloroacetamide |
|---|---|
| Synonyms | N-[(1S)-1-(4-Bromophenyl)Ethyl]-2-Chloro-Acetamide; N-[(1S)-1-(4-Bromophenyl)Ethyl]-2-Chloro-Ethanamide; Zinc03394045 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11BrClNO |
| Molecular Weight | 276.56 |
| CAS Registry Number | 91687-65-9 |
| SMILES | [C@H](NC(=O)CCl)(C)C1=CC=C(Br)C=C1 |
| InChI | 1S/C10H11BrClNO/c1-7(13-10(14)6-12)8-2-4-9(11)5-3-8/h2-5,7H,6H2,1H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | QOVVMRZOAXDWMK-ZETCQYMHSA-N |
| Density | 1.459g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.559°C at 760 mmHg (Cal.) |
| Flash point | 211.775°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-[1-(4-Bromophenyl)Ethyl]-2-Chloroacetamide |